C14H17N3O2S — CID 114795765
4-(naphthalen-1-ylsulfonylamino)butanimidamide (PubChem CID 114795765) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-(naphthalen-1-ylsulfonylamino)butanimidamide.
| Compound Name | 4-(naphthalen-1-ylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 114795765 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-(naphthalen-1-ylsulfonylamino)butanimidamide |
| SMILES | [H]/N=C(\N)CCCNS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H17N3O2S/c15-14(16)9-4-10-17-20(18,19)13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8,17H,4,9-10H2,(H3,15,16) |
| InChIKey | FVVVOQHLBOYMCB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|