C15H19N3O2S — CID 114795769
2-methyl-2-(naphthalen-1-ylsulfonylamino)butanimidamide (PubChem CID 114795769) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-methyl-2-(naphthalen-1-ylsulfonylamino)butanimidamide.
| Compound Name | 2-methyl-2-(naphthalen-1-ylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 114795769 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-methyl-2-(naphthalen-1-ylsulfonylamino)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(CC)NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-15(2,14(16)17)18-21(19,20)13-10-6-8-11-7-4-5-9-12(11)13/h4-10,18H,3H2,1-2H3,(H3,16,17) |
| InChIKey | LCWVUKVYZKOPIM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|