C10H13ClF4N2O2S — CID 91659841
N-(3-aminopropyl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 91659841) has the molecular formula C10H13ClF4N2O2S and a molecular weight of 336.74 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 91659841 |
| Molecular Formula | C10H13ClF4N2O2S |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-(3-aminopropyl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCNS(=O)(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H12F4N2O2S.ClH/c11-8-3-2-7(10(12,13)14)6-9(8)19(17,18)16-5-1-4-15;/h2-3,6,16H,1,4-5,15H2;1H |
| InChIKey | JHAYCZZVSZGXAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|