C10H14F3N3O2S — CID 113327826
2-hydrazinyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide (PubChem CID 113327826) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-hydrazinyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113327826 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-hydrazinyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
| SMILES | NNc1ccccc1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2S/c11-10(12,13)6-3-7-15-19(17,18)9-5-2-1-4-8(9)16-14/h1-2,4-5,15-16H,3,6-7,14H2 |
| InChIKey | SHPZMEWSIOBBLW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|