C10H10F4N2O4S — CID 115663345
3-fluoro-2-nitro-N-(4,4,4-trifluorobutyl)benzenesulfonamide (PubChem CID 115663345) has the molecular formula C10H10F4N2O4S and a molecular weight of 330.26 g/mol. Its IUPAC name is 3-fluoro-2-nitro-N-(4,4,4-trifluorobutyl)benzenesulfonamide.
| Compound Name | 3-fluoro-2-nitro-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115663345 |
| Molecular Formula | C10H10F4N2O4S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-fluoro-2-nitro-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1c(F)cccc1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H10F4N2O4S/c11-7-3-1-4-8(9(7)16(17)18)21(19,20)15-6-2-5-10(12,13)14/h1,3-4,15H,2,5-6H2 |
| InChIKey | DBKVPWMHZQJTEF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|