C12H12F4N2O2S — CID 115486680
2-cyano-3-fluoro-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115486680) has the molecular formula C12H12F4N2O2S and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 2-cyano-3-fluoro-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115486680 |
| Molecular Formula | C12H12F4N2O2S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-cyano-3-fluoro-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C12H12F4N2O2S/c13-10-4-3-5-11(9(10)8-17)21(19,20)18-7-2-1-6-12(14,15)16/h3-5,18H,1-2,6-7H2 |
| InChIKey | NOMSLZBFBFMSKM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|