C13H17FN2O2S — CID 115753532
2-cyano-N-(2-ethylbutyl)-3-fluorobenzenesulfonamide (PubChem CID 115753532) has the molecular formula C13H17FN2O2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-cyano-N-(2-ethylbutyl)-3-fluorobenzenesulfonamide.
| Compound Name | 2-cyano-N-(2-ethylbutyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115753532 |
| Molecular Formula | C13H17FN2O2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-cyano-N-(2-ethylbutyl)-3-fluorobenzenesulfonamide |
| SMILES | CCC(CC)CNS(=O)(=O)c1cccc(F)c1C#N |
| InChI | InChI=1S/C13H17FN2O2S/c1-3-10(4-2)9-16-19(17,18)13-7-5-6-12(14)11(13)8-15/h5-7,10,16H,3-4,9H2,1-2H3 |
| InChIKey | CLAOQWODGVJHPA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |