C12H14FN3O3S — CID 103916474
5-[(2-cyano-3-fluorophenyl)sulfonylamino]pentanamide (PubChem CID 103916474) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-[(2-cyano-3-fluorophenyl)sulfonylamino]pentanamide.
| Compound Name | 5-[(2-cyano-3-fluorophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 103916474 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-[(2-cyano-3-fluorophenyl)sulfonylamino]pentanamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C12H14FN3O3S/c13-10-4-3-5-11(9(10)8-14)20(18,19)16-7-2-1-6-12(15)17/h3-5,16H,1-2,6-7H2,(H2,15,17) |
| InChIKey | YRHHUVQFUVGLRT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|