C13H15FN2O4S — CID 104934664
(2S)-2-[(2-cyano-3-fluorophenyl)sulfonylamino]hexanoic acid (PubChem CID 104934664) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S)-2-[(2-cyano-3-fluorophenyl)sulfonylamino]hexanoic acid.
| Compound Name | (2S)-2-[(2-cyano-3-fluorophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 104934664 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2S)-2-[(2-cyano-3-fluorophenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCC[C@H](NS(=O)(=O)c1cccc(F)c1C#N)C(=O)O |
| InChI | InChI=1S/C13H15FN2O4S/c1-2-3-6-11(13(17)18)16-21(19,20)12-7-4-5-10(14)9(12)8-15/h4-5,7,11,16H,2-3,6H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | BPGDXTAGKVIJHS-NSHDSACASA-N |
| XLogP | 1.62 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |