C9H8F4N2O4S — CID 115589530
3-fluoro-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 115589530) has the molecular formula C9H8F4N2O4S and a molecular weight of 316.23 g/mol. Its IUPAC name is 3-fluoro-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115589530 |
| Molecular Formula | C9H8F4N2O4S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-fluoro-N-methyl-2-nitro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8F4N2O4S/c1-14(5-9(11,12)13)20(18,19)7-4-2-3-6(10)8(7)15(16)17/h2-4H,5H2,1H3 |
| InChIKey | SOJSVEPZCBEZFH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|