C10H11Cl2FN2O4S — CID 115993134
N,N-bis(2-chloroethyl)-3-fluoro-2-nitrobenzenesulfonamide (PubChem CID 115993134) has the molecular formula C10H11Cl2FN2O4S and a molecular weight of 345.18 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-3-fluoro-2-nitrobenzenesulfonamide.
| Compound Name | N,N-bis(2-chloroethyl)-3-fluoro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115993134 |
| Molecular Formula | C10H11Cl2FN2O4S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | N,N-bis(2-chloroethyl)-3-fluoro-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1c(F)cccc1S(=O)(=O)N(CCCl)CCCl |
| InChI | InChI=1S/C10H11Cl2FN2O4S/c11-4-6-14(7-5-12)20(18,19)9-3-1-2-8(13)10(9)15(16)17/h1-3H,4-7H2 |
| InChIKey | KTUXWWTWQUAYGW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|