C11H17N3O6S — CID 115993466
N,N-bis(2-hydroxyethyl)-3-(methylamino)-2-nitrobenzenesulfonamide (PubChem CID 115993466) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-(methylamino)-2-nitrobenzenesulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-(methylamino)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115993466 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-(methylamino)-2-nitrobenzenesulfonamide |
| SMILES | CNc1cccc(S(=O)(=O)N(CCO)CCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O6S/c1-12-9-3-2-4-10(11(9)14(17)18)21(19,20)13(5-7-15)6-8-16/h2-4,12,15-16H,5-8H2,1H3 |
| InChIKey | KFNUKDFSPRBZCY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|