C12H17FN2O5S — CID 115992192
3-fluoro-N-(3-hydroxypropyl)-2-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 115992192) has the molecular formula C12H17FN2O5S and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-fluoro-N-(3-hydroxypropyl)-2-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-(3-hydroxypropyl)-2-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 115992192 |
| Molecular Formula | C12H17FN2O5S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-fluoro-N-(3-hydroxypropyl)-2-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(CCCO)S(=O)(=O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17FN2O5S/c1-9(2)14(7-4-8-16)21(19,20)11-6-3-5-10(13)12(11)15(17)18/h3,5-6,9,16H,4,7-8H2,1-2H3 |
| InChIKey | LYVAQFNVARRBJW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|