C9H10FN3O5S — CID 112686222
2-[(3-fluoro-2-nitrophenyl)sulfonyl-methylamino]acetamide (PubChem CID 112686222) has the molecular formula C9H10FN3O5S and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[(3-fluoro-2-nitrophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | 2-[(3-fluoro-2-nitrophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 112686222 |
| Molecular Formula | C9H10FN3O5S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[(3-fluoro-2-nitrophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)S(=O)(=O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10FN3O5S/c1-12(5-8(11)14)19(17,18)7-4-2-3-6(10)9(7)13(15)16/h2-4H,5H2,1H3,(H2,11,14) |
| InChIKey | YCFXYLKGLMVMLB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|