C9H11F2N3O3S — CID 107343162
2-[(3-amino-2,4-difluorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 107343162) has the molecular formula C9H11F2N3O3S and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[(3-amino-2,4-difluorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | 2-[(3-amino-2,4-difluorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 107343162 |
| Molecular Formula | C9H11F2N3O3S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[(3-amino-2,4-difluorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)S(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C9H11F2N3O3S/c1-14(4-7(12)15)18(16,17)6-3-2-5(10)9(13)8(6)11/h2-3H,4,13H2,1H3,(H2,12,15) |
| InChIKey | IJXPGXIOKDMWHQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|