C13H14F2N2O3S — CID 107343380
3-amino-2,4-difluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzenesulfonamide (PubChem CID 107343380) has the molecular formula C13H14F2N2O3S and a molecular weight of 316.33 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107343380 |
| Molecular Formula | C13H14F2N2O3S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-amino-2,4-difluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzenesulfonamide |
| SMILES | Cc1occc1CN(C)S(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C13H14F2N2O3S/c1-8-9(5-6-20-8)7-17(2)21(18,19)11-4-3-10(14)13(16)12(11)15/h3-6H,7,16H2,1-2H3 |
| InChIKey | HAZMVNIVWGJKGF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|