C12H18N4O3S — CID 61426376
3-amino-1-ethyl-N-methyl-N-[(2-methylfuran-3-yl)methyl]pyrazole-4-sulfonamide (PubChem CID 61426376) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-methyl-N-[(2-methylfuran-3-yl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-methyl-N-[(2-methylfuran-3-yl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61426376 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-amino-1-ethyl-N-methyl-N-[(2-methylfuran-3-yl)methyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(C)Cc2ccoc2C)c(N)n1 |
| InChI | InChI=1S/C12H18N4O3S/c1-4-16-8-11(12(13)14-16)20(17,18)15(3)7-10-5-6-19-9(10)2/h5-6,8H,4,7H2,1-3H3,(H2,13,14) |
| InChIKey | JMGXOQDCCHOJNC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |