C8H16N4O2S — CID 60807966
3-amino-N,1-diethyl-N-methylpyrazole-4-sulfonamide (PubChem CID 60807966) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is 3-amino-N,1-diethyl-N-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N,1-diethyl-N-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60807966 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-amino-N,1-diethyl-N-methylpyrazole-4-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1cn(CC)nc1N |
| InChI | InChI=1S/C8H16N4O2S/c1-4-11(3)15(13,14)7-6-12(5-2)10-8(7)9/h6H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | UOOKFOXDVGQASG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |