C9H18N4O2S — CID 60814031
3-amino-N-tert-butyl-1-ethylpyrazole-4-sulfonamide (PubChem CID 60814031) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-amino-N-tert-butyl-1-ethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-tert-butyl-1-ethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60814031 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-amino-N-tert-butyl-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)(C)C)c(N)n1 |
| InChI | InChI=1S/C9H18N4O2S/c1-5-13-6-7(8(10)11-13)16(14,15)12-9(2,3)4/h6,12H,5H2,1-4H3,(H2,10,11) |
| InChIKey | NUGQLQNHDIVJSP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |