C11H21N5O3S — CID 61114473
2-[(3-amino-1-ethylpyrazol-4-yl)sulfonyl-ethylamino]-N-ethylacetamide (PubChem CID 61114473) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[(3-amino-1-ethylpyrazol-4-yl)sulfonyl-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(3-amino-1-ethylpyrazol-4-yl)sulfonyl-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 61114473 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[(3-amino-1-ethylpyrazol-4-yl)sulfonyl-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)c1cn(CC)nc1N |
| InChI | InChI=1S/C11H21N5O3S/c1-4-13-10(17)8-16(6-3)20(18,19)9-7-15(5-2)14-11(9)12/h7H,4-6,8H2,1-3H3,(H2,12,14)(H,13,17) |
| InChIKey | FDYSKRYGRVZRMI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |