C13H19FN2O3S — CID 39633113
N-ethyl-2-[ethyl-(5-fluoro-2-methylphenyl)sulfonylamino]acetamide (PubChem CID 39633113) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is N-ethyl-2-[ethyl-(5-fluoro-2-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-ethyl-2-[ethyl-(5-fluoro-2-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 39633113 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-ethyl-2-[ethyl-(5-fluoro-2-methylphenyl)sulfonylamino]acetamide |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C13H19FN2O3S/c1-4-15-13(17)9-16(5-2)20(18,19)12-8-11(14)7-6-10(12)3/h6-8H,4-5,9H2,1-3H3,(H,15,17) |
| InChIKey | KSOGOVLAOQFXRP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |