C16H21FN4O3S — CID 71854645
N-ethyl-2-[ethyl-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]sulfonylamino]acetamide (PubChem CID 71854645) has the molecular formula C16H21FN4O3S and a molecular weight of 368.43 g/mol. Its IUPAC name is N-ethyl-2-[ethyl-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]sulfonylamino]acetamide.
| Compound Name | N-ethyl-2-[ethyl-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 71854645 |
| Molecular Formula | C16H21FN4O3S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-ethyl-2-[ethyl-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]sulfonylamino]acetamide |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)c1cnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C16H21FN4O3S/c1-4-18-16(22)11-20(5-2)25(23,24)15-10-19-21(12(15)3)14-8-6-13(17)7-9-14/h6-10H,4-5,11H2,1-3H3,(H,18,22) |
| InChIKey | HMIYUWQTHXFARR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |