C20H24FN3O4S — CID 17475869
N,N-diethyl-5-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]-2-methylbenzenesulfonamide (PubChem CID 17475869) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is N,N-diethyl-5-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]-2-methylbenzenesulfonamide.
| Compound Name | N,N-diethyl-5-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 17475869 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N,N-diethyl-5-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]-2-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NNC(=O)Cc2ccc(F)cc2)ccc1C |
| InChI | InChI=1S/C20H24FN3O4S/c1-4-24(5-2)29(27,28)18-13-16(9-6-14(18)3)20(26)23-22-19(25)12-15-7-10-17(21)11-8-15/h6-11,13H,4-5,12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | NOUQBHMMKCASJT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|