C11H14N2O3S2 — CID 61426476
4-amino-N-methyl-N-[(2-methylfuran-3-yl)methyl]thiophene-2-sulfonamide (PubChem CID 61426476) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[(2-methylfuran-3-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-methyl-N-[(2-methylfuran-3-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61426476 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-amino-N-methyl-N-[(2-methylfuran-3-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1occc1CN(C)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C11H14N2O3S2/c1-8-9(3-4-16-8)6-13(2)18(14,15)11-5-10(12)7-17-11/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | QXVZTZZXHQACND-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |