C9H14ClNO3S — CID 107651758
2-chloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]ethanesulfonamide (PubChem CID 107651758) has the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651758 |
| Molecular Formula | C9H14ClNO3S |
| Molecular Weight | 251.73 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-chloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]ethanesulfonamide |
| SMILES | Cc1occc1CN(C)S(=O)(=O)CCCl |
| InChI | InChI=1S/C9H14ClNO3S/c1-8-9(3-5-14-8)7-11(2)15(12,13)6-4-10/h3,5H,4,6-7H2,1-2H3 |
| InChIKey | JXIAUTOUFDXVRF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.73 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|