C12H17FN2O4S — CID 47331562
N-(3,3-dimethylbutyl)-3-fluoro-2-nitrobenzenesulfonamide (PubChem CID 47331562) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-3-fluoro-2-nitrobenzenesulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-3-fluoro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 47331562 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(3,3-dimethylbutyl)-3-fluoro-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)CCNS(=O)(=O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17FN2O4S/c1-12(2,3)7-8-14-20(18,19)10-6-4-5-9(13)11(10)15(16)17/h4-6,14H,7-8H2,1-3H3 |
| InChIKey | BYVVZKLNNXGXGK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|