C10H13FN2O5S2 — CID 115763672
3-fluoro-N-(2-methylsulfinylpropyl)-2-nitrobenzenesulfonamide (PubChem CID 115763672) has the molecular formula C10H13FN2O5S2 and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-fluoro-N-(2-methylsulfinylpropyl)-2-nitrobenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-methylsulfinylpropyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115763672 |
| Molecular Formula | C10H13FN2O5S2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-fluoro-N-(2-methylsulfinylpropyl)-2-nitrobenzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cccc(F)c1[N+](=O)[O-])S(C)=O |
| InChI | InChI=1S/C10H13FN2O5S2/c1-7(19(2)16)6-12-20(17,18)9-5-3-4-8(11)10(9)13(14)15/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | JZZAECHHDPIPAR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|