C11H15FN2O5S2 — CID 115967741
4-fluoro-2-methyl-N-(2-methylsulfinylpropyl)-5-nitrobenzenesulfonamide (PubChem CID 115967741) has the molecular formula C11H15FN2O5S2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(2-methylsulfinylpropyl)-5-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-(2-methylsulfinylpropyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115967741 |
| Molecular Formula | C11H15FN2O5S2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-fluoro-2-methyl-N-(2-methylsulfinylpropyl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(F)c([N+](=O)[O-])cc1S(=O)(=O)NCC(C)S(C)=O |
| InChI | InChI=1S/C11H15FN2O5S2/c1-7-4-9(12)10(14(15)16)5-11(7)21(18,19)13-6-8(2)20(3)17/h4-5,8,13H,6H2,1-3H3 |
| InChIKey | BCKRVSGPCPTOPC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|