C10H14FNO3S2 — CID 115763664
2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide (PubChem CID 115763664) has the molecular formula C10H14FNO3S2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115763664 |
| Molecular Formula | C10H14FNO3S2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1ccccc1F)S(C)=O |
| InChI | InChI=1S/C10H14FNO3S2/c1-8(16(2)13)7-12-17(14,15)10-6-4-3-5-9(10)11/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | RKXSNGAUKJQOTP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |