C12H18FNO2S — CID 64570507
N-(2,3-dimethylbutyl)-2-fluorobenzenesulfonamide (PubChem CID 64570507) has the molecular formula C12H18FNO2S and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(2,3-dimethylbutyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 64570507 |
| Molecular Formula | C12H18FNO2S |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2,3-dimethylbutyl)-2-fluorobenzenesulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C12H18FNO2S/c1-9(2)10(3)8-14-17(15,16)12-7-5-4-6-11(12)13/h4-7,9-10,14H,8H2,1-3H3 |
| InChIKey | CXTRSIRAQUDSSN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |