C12H20N2O4S2 — CID 64596836
2-N-(2,3-dimethylbutyl)benzene-1,2-disulfonamide (PubChem CID 64596836) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutyl)benzene-1,2-disulfonamide.
| Compound Name | 2-N-(2,3-dimethylbutyl)benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 64596836 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-N-(2,3-dimethylbutyl)benzene-1,2-disulfonamide |
| SMILES | CC(C)C(C)CNS(=O)(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H20N2O4S2/c1-9(2)10(3)8-14-20(17,18)12-7-5-4-6-11(12)19(13,15)16/h4-7,9-10,14H,8H2,1-3H3,(H2,13,15,16) |
| InChIKey | DXCZDRGALKGWLG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |