C11H15F3N2O2S — CID 115522029
2-(methylamino)-N-(4,4,4-trifluorobutyl)benzenesulfonamide (PubChem CID 115522029) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-(methylamino)-N-(4,4,4-trifluorobutyl)benzenesulfonamide.
| Compound Name | 2-(methylamino)-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115522029 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(methylamino)-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
| SMILES | CNc1ccccc1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2S/c1-15-9-5-2-3-6-10(9)19(17,18)16-8-4-7-11(12,13)14/h2-3,5-6,15-16H,4,7-8H2,1H3 |
| InChIKey | MTWPWVSWKPYXND-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|