C13H17F3N2O2S — CID 115520486
N-cyclopropyl-2-(4,4,4-trifluorobutylamino)benzenesulfonamide (PubChem CID 115520486) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-cyclopropyl-2-(4,4,4-trifluorobutylamino)benzenesulfonamide.
| Compound Name | N-cyclopropyl-2-(4,4,4-trifluorobutylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115520486 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-cyclopropyl-2-(4,4,4-trifluorobutylamino)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccccc1NCCCC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O2S/c14-13(15,16)8-3-9-17-11-4-1-2-5-12(11)21(19,20)18-10-6-7-10/h1-2,4-5,10,17-18H,3,6-9H2 |
| InChIKey | HVMDHLADKWVFMR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|