C12H17N3O4S — CID 83204510
2-[2-(cyclopropylsulfamoyl)anilino]ethyl carbamate (PubChem CID 83204510) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfamoyl)anilino]ethyl carbamate.
| Compound Name | 2-[2-(cyclopropylsulfamoyl)anilino]ethyl carbamate |
|---|---|
| PubChem CID | 83204510 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[2-(cyclopropylsulfamoyl)anilino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1ccccc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C12H17N3O4S/c13-12(16)19-8-7-14-10-3-1-2-4-11(10)20(17,18)15-9-5-6-9/h1-4,9,14-15H,5-8H2,(H2,13,16) |
| InChIKey | AVIVGJAYOOOIOI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|