C14H23N3O2S — CID 79350502
2-hydrazinyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzenesulfonamide (PubChem CID 79350502) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79350502 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-hydrazinyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzenesulfonamide |
| SMILES | CC1(C)C(CNS(=O)(=O)c2ccccc2NN)C1(C)C |
| InChI | InChI=1S/C14H23N3O2S/c1-13(2)12(14(13,3)4)9-16-20(18,19)11-8-6-5-7-10(11)17-15/h5-8,12,16-17H,9,15H2,1-4H3 |
| InChIKey | KKOOQCVZFRKAMT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|