C13H23N3O2S — CID 113287642
2-hydrazinyl-N-(5-methylhexyl)benzenesulfonamide (PubChem CID 113287642) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-hydrazinyl-N-(5-methylhexyl)benzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-(5-methylhexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113287642 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-hydrazinyl-N-(5-methylhexyl)benzenesulfonamide |
| SMILES | CC(C)CCCCNS(=O)(=O)c1ccccc1NN |
| InChI | InChI=1S/C13H23N3O2S/c1-11(2)7-5-6-10-15-19(17,18)13-9-4-3-8-12(13)16-14/h3-4,8-9,11,15-16H,5-7,10,14H2,1-2H3 |
| InChIKey | SDGZZMJOWYAHOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|