C14H25N3O2S — CID 61377131
2-hydrazinyl-N,N-bis(2-methylpropyl)benzenesulfonamide (PubChem CID 61377131) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-bis(2-methylpropyl)benzenesulfonamide.
| Compound Name | 2-hydrazinyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61377131 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-hydrazinyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccccc1NN |
| InChI | InChI=1S/C14H25N3O2S/c1-11(2)9-17(10-12(3)4)20(18,19)14-8-6-5-7-13(14)16-15/h5-8,11-12,16H,9-10,15H2,1-4H3 |
| InChIKey | UZYWFPPUKGVRAC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|