C9H12F3N3O2S — CID 60890269
2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60890269) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60890269 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1ccccc1NN |
| InChI | InChI=1S/C9H12F3N3O2S/c1-15(6-9(10,11)12)18(16,17)8-5-3-2-4-7(8)14-13/h2-5,14H,6,13H2,1H3 |
| InChIKey | KXMRYUHSAZSHOI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|