C12H13F3N2O2S — CID 60891603
2-(3-aminoprop-1-ynyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60891603) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60891603 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1ccccc1C#CCN |
| InChI | InChI=1S/C12H13F3N2O2S/c1-17(9-12(13,14)15)20(18,19)11-7-3-2-5-10(11)6-4-8-16/h2-3,5,7H,8-9,16H2,1H3 |
| InChIKey | CPGACLNQGVXZAX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|