C9H10F3NO2S — CID 60762861
N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60762861) has the molecular formula C9H10F3NO2S and a molecular weight of 253.25 g/mol. Its IUPAC name is N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60762861 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-13(7-9(10,11)12)16(14,15)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | GEDGZJJPSMFUMO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |