C10H11F3N2O2S2 — CID 60890642
3-[methyl(2,2,2-trifluoroethyl)sulfamoyl]benzenecarbothioamide (PubChem CID 60890642) has the molecular formula C10H11F3N2O2S2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-[methyl(2,2,2-trifluoroethyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[methyl(2,2,2-trifluoroethyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 60890642 |
| Molecular Formula | C10H11F3N2O2S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-[methyl(2,2,2-trifluoroethyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C10H11F3N2O2S2/c1-15(6-10(11,12)13)19(16,17)8-4-2-3-7(5-8)9(14)18/h2-5H,6H2,1H3,(H2,14,18) |
| InChIKey | DWPNMFJEDDSTIS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|