C12H14F3NO3S — CID 61384500
3-acetyl-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 61384500) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 3-acetyl-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 3-acetyl-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61384500 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-acetyl-N-methyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N(C)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-9(17)10-4-3-5-11(8-10)20(18,19)16(2)7-6-12(13,14)15/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | AIZKCULFLNGWLZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |