C16H17F3N2O4S2 — CID 57430751
N-(3-aminopropyl)-5-(benzenesulfonyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 57430751) has the molecular formula C16H17F3N2O4S2 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-(benzenesulfonyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-5-(benzenesulfonyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57430751 |
| Molecular Formula | C16H17F3N2O4S2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-(3-aminopropyl)-5-(benzenesulfonyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCCCNS(=O)(=O)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O4S2/c17-16(18,19)14-8-7-13(26(22,23)12-5-2-1-3-6-12)11-15(14)27(24,25)21-10-4-9-20/h1-3,5-8,11,21H,4,9-10,20H2 |
| InChIKey | KXNIHOVLBXNBJA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|