C23H29F3N4O5S2 — CID 57430741
1-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-1-methyl-3-piperidin-4-ylurea (PubChem CID 57430741) has the molecular formula C23H29F3N4O5S2 and a molecular weight of 562.64 g/mol. Its IUPAC name is 1-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-1-methyl-3-piperidin-4-ylurea.
| Compound Name | 1-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-1-methyl-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 57430741 |
| Molecular Formula | C23H29F3N4O5S2 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 1-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-1-methyl-3-piperidin-4-ylurea |
| SMILES | CN(CCCNS(=O)(=O)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C23H29F3N4O5S2/c1-30(22(31)29-17-10-13-27-14-11-17)15-5-12-28-37(34,35)21-16-19(8-9-20(21)23(24,25)26)36(32,33)18-6-3-2-4-7-18/h2-4,6-9,16-17,27-28H,5,10-15H2,1H3,(H,29,31) |
| InChIKey | KSVVPYRPWNCBJU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|