C17H18F3N3O5S2 — CID 141159589
1-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]-1-methylurea (PubChem CID 141159589) has the molecular formula C17H18F3N3O5S2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]-1-methylurea.
| Compound Name | 1-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]-1-methylurea |
|---|---|
| PubChem CID | 141159589 |
| Molecular Formula | C17H18F3N3O5S2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 1-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]-1-methylurea |
| SMILES | CN(CCNS(=O)(=O)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C17H18F3N3O5S2/c1-23(16(21)24)10-9-22-30(27,28)15-11-13(7-8-14(15)17(18,19)20)29(25,26)12-5-3-2-4-6-12/h2-8,11,22H,9-10H2,1H3,(H2,21,24) |
| InChIKey | LEEACOBNECJUIF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |