C16H14F3N2O6S2- — CID 57458076
N-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 57458076) has the molecular formula C16H14F3N2O6S2- and a molecular weight of 451.42 g/mol. Its IUPAC name is N-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | N-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 57458076 |
| Molecular Formula | C16H14F3N2O6S2- |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[2-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNS(=O)(=O)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O6S2/c17-16(18,19)13-7-6-12(28(24,25)11-4-2-1-3-5-11)10-14(13)29(26,27)21-9-8-20-15(22)23/h1-7,10,20-21H,8-9H2,(H,22,23)/p-1 |
| InChIKey | WAPZMAOMMCJTCO-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|