C19H20F3NO5S2 — CID 57430520
5-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 57430520) has the molecular formula C19H20F3NO5S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57430520 |
| Molecular Formula | C19H20F3NO5S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 5-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCOCC1)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO5S2/c20-19(21,22)17-7-6-16(29(24,25)15-4-2-1-3-5-15)12-18(17)30(26,27)23-13-14-8-10-28-11-9-14/h1-7,12,14,23H,8-11,13H2 |
| InChIKey | HMDRIFCYYPAPJF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |