C21H21F3N2O5S2 — CID 24947558
1-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)indole-3-sulfonamide (PubChem CID 24947558) has the molecular formula C21H21F3N2O5S2 and a molecular weight of 502.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)indole-3-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)indole-3-sulfonamide |
|---|---|
| PubChem CID | 24947558 |
| Molecular Formula | C21H21F3N2O5S2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)indole-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCOCC1)c1cn(S(=O)(=O)c2ccccc2)c2cccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H21F3N2O5S2/c22-21(23,24)17-7-4-8-18-20(17)19(32(27,28)25-13-15-9-11-31-12-10-15)14-26(18)33(29,30)16-5-2-1-3-6-16/h1-8,14-15,25H,9-13H2 |
| InChIKey | HUHPRBVVBYBQQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |