C20H23F3N2O4S2 — CID 57430534
5-(benzenesulfonyl)-N-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 57430534) has the molecular formula C20H23F3N2O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 5-(benzenesulfonyl)-N-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57430534 |
| Molecular Formula | C20H23F3N2O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 5-(benzenesulfonyl)-N-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1CCNCC1)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O4S2/c21-20(22,23)18-7-6-17(30(26,27)16-4-2-1-3-5-16)14-19(18)31(28,29)25-13-10-15-8-11-24-12-9-15/h1-7,14-15,24-25H,8-13H2 |
| InChIKey | CCTIRNHWXBAUNN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |