C22H27F3N4O5S2 — CID 57430743
N-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-N-methylpiperazine-1-carboxamide (PubChem CID 57430743) has the molecular formula C22H27F3N4O5S2 and a molecular weight of 548.61 g/mol. Its IUPAC name is N-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-N-methylpiperazine-1-carboxamide.
| Compound Name | N-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-N-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 57430743 |
| Molecular Formula | C22H27F3N4O5S2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | N-[3-[[5-(benzenesulfonyl)-2-(trifluoromethyl)phenyl]sulfonylamino]propyl]-N-methylpiperazine-1-carboxamide |
| SMILES | CN(CCCNS(=O)(=O)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C22H27F3N4O5S2/c1-28(21(30)29-14-11-26-12-15-29)13-5-10-27-36(33,34)20-16-18(8-9-19(20)22(23,24)25)35(31,32)17-6-3-2-4-7-17/h2-4,6-9,16,26-27H,5,10-15H2,1H3 |
| InChIKey | RVDYWSQAYCAKSX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|